C16H22BrNO — CID 43628365
[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-4-bromophenyl]methanol (PubChem CID 43628365) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is [2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-4-bromophenyl]methanol.
| Compound Name | [2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-4-bromophenyl]methanol |
|---|---|
| PubChem CID | 43628365 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-4-bromophenyl]methanol |
| SMILES | OCc1ccc(Br)cc1N1CCCC2CCCCC21 |
| InChI | InChI=1S/C16H22BrNO/c17-14-8-7-13(11-19)16(10-14)18-9-3-5-12-4-1-2-6-15(12)18/h7-8,10,12,15,19H,1-6,9,11H2 |
| InChIKey | UXMILVRUYUXAJC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |