C16H23BrN2 — CID 102725431
[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-5-bromophenyl]methanamine (PubChem CID 102725431) has the molecular formula C16H23BrN2 and a molecular weight of 323.28 g/mol. Its IUPAC name is [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-5-bromophenyl]methanamine.
| Compound Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-5-bromophenyl]methanamine |
|---|---|
| PubChem CID | 102725431 |
| Molecular Formula | C16H23BrN2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-5-bromophenyl]methanamine |
| SMILES | NCc1cc(Br)ccc1N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C16H23BrN2/c17-14-7-8-16(13(10-14)11-18)19-9-3-5-12-4-1-2-6-15(12)19/h7-8,10,12,15H,1-6,9,11,18H2/t12-,15-/m1/s1 |
| InChIKey | BELOFUUHJQXWCQ-IUODEOHRSA-N |
| XLogP | 4.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |