C15H22BrN3 — CID 102728419
[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-5-bromo-3-pyridinyl]methanamine (PubChem CID 102728419) has the molecular formula C15H22BrN3 and a molecular weight of 324.27 g/mol. Its IUPAC name is [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-5-bromo-3-pyridinyl]methanamine.
| Compound Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-5-bromo-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 102728419 |
| Molecular Formula | C15H22BrN3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | [2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-5-bromo-3-pyridinyl]methanamine |
| SMILES | NCc1cc(Br)cnc1N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H22BrN3/c16-13-8-12(9-17)15(18-10-13)19-7-3-5-11-4-1-2-6-14(11)19/h8,10-11,14H,1-7,9,17H2/t11-,14-/m1/s1 |
| InChIKey | UJVLJJHPONMXSQ-BXUZGUMPSA-N |
| XLogP | 3.46 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |