C10H12BrN3 — CID 130625562
[5-bromo-2-(2,5-dihydropyrrol-1-yl)-3-pyridinyl]methanamine (PubChem CID 130625562) has the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. Its IUPAC name is [5-bromo-2-(2,5-dihydropyrrol-1-yl)-3-pyridinyl]methanamine.
| Compound Name | [5-bromo-2-(2,5-dihydropyrrol-1-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 130625562 |
| Molecular Formula | C10H12BrN3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | [5-bromo-2-(2,5-dihydropyrrol-1-yl)-3-pyridinyl]methanamine |
| SMILES | NCc1cc(Br)cnc1N1CC=CC1 |
| InChI | InChI=1S/C10H12BrN3/c11-9-5-8(6-12)10(13-7-9)14-3-1-2-4-14/h1-2,5,7H,3-4,6,12H2 |
| InChIKey | SNEDSVFQFPJWAI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|