C13H20BrN3 — CID 62285532
[5-bromo-2-(4-ethylpiperidin-1-yl)-3-pyridinyl]methanamine (PubChem CID 62285532) has the molecular formula C13H20BrN3 and a molecular weight of 298.23 g/mol. Its IUPAC name is [5-bromo-2-(4-ethylpiperidin-1-yl)-3-pyridinyl]methanamine.
| Compound Name | [5-bromo-2-(4-ethylpiperidin-1-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 62285532 |
| Molecular Formula | C13H20BrN3 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | [5-bromo-2-(4-ethylpiperidin-1-yl)-3-pyridinyl]methanamine |
| SMILES | CCC1CCN(c2ncc(Br)cc2CN)CC1 |
| InChI | InChI=1S/C13H20BrN3/c1-2-10-3-5-17(6-4-10)13-11(8-15)7-12(14)9-16-13/h7,9-10H,2-6,8,15H2,1H3 |
| InChIKey | VWVZMJWYAYTIRN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |