C15H22ClN3 — CID 107055207
[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-chloro-4-pyridinyl]methanamine (PubChem CID 107055207) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is [2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-chloro-4-pyridinyl]methanamine.
| Compound Name | [2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-chloro-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 107055207 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-chloro-4-pyridinyl]methanamine |
| SMILES | NCc1ccnc(N2CCCC3CCCCC32)c1Cl |
| InChI | InChI=1S/C15H22ClN3/c16-14-12(10-17)7-8-18-15(14)19-9-3-5-11-4-1-2-6-13(11)19/h7-8,11,13H,1-6,9-10,17H2 |
| InChIKey | GABBKEYZHKFBQM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |