C18H27N3 — CID 62294591
N-[[2-(2-cyclopentylpyrrolidin-1-yl)-3-pyridinyl]methyl]cyclopropanamine (PubChem CID 62294591) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is N-[[2-(2-cyclopentylpyrrolidin-1-yl)-3-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(2-cyclopentylpyrrolidin-1-yl)-3-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62294591 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-[[2-(2-cyclopentylpyrrolidin-1-yl)-3-pyridinyl]methyl]cyclopropanamine |
| SMILES | c1cnc(N2CCCC2C2CCCC2)c(CNC2CC2)c1 |
| InChI | InChI=1S/C18H27N3/c1-2-6-14(5-1)17-8-4-12-21(17)18-15(7-3-11-19-18)13-20-16-9-10-16/h3,7,11,14,16-17,20H,1-2,4-6,8-10,12-13H2 |
| InChIKey | DTGPLDGWGKXWEV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |