C17H25N3 — CID 82752978
N-[[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine (PubChem CID 82752978) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is N-[[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 82752978 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N-[[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine |
| SMILES | c1cnc(N2CCC3CCCCC32)c(CNC2CC2)c1 |
| InChI | InChI=1S/C17H25N3/c1-2-6-16-13(4-1)9-11-20(16)17-14(5-3-10-18-17)12-19-15-7-8-15/h3,5,10,13,15-16,19H,1-2,4,6-9,11-12H2 |
| InChIKey | BUDKXWRMSKFGIT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |