C12H18N4 — CID 103739512
3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrazin-2-amine (PubChem CID 103739512) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrazin-2-amine.
| Compound Name | 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 103739512 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)pyrazin-2-amine |
| SMILES | Nc1nccnc1N1CCC2CCCCC21 |
| InChI | InChI=1S/C12H18N4/c13-11-12(15-7-6-14-11)16-8-5-9-3-1-2-4-10(9)16/h6-7,9-10H,1-5,8H2,(H2,13,14) |
| InChIKey | VJWUMSFITGQEHW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |