C9H13FN4 — CID 130908577
3-[2-(fluoromethyl)pyrrolidin-1-yl]pyrazin-2-amine (PubChem CID 130908577) has the molecular formula C9H13FN4 and a molecular weight of 196.23 g/mol. Its IUPAC name is 3-[2-(fluoromethyl)pyrrolidin-1-yl]pyrazin-2-amine.
| Compound Name | 3-[2-(fluoromethyl)pyrrolidin-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 130908577 |
| Molecular Formula | C9H13FN4 |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-[2-(fluoromethyl)pyrrolidin-1-yl]pyrazin-2-amine |
| SMILES | Nc1nccnc1N1CCCC1CF |
| InChI | InChI=1S/C9H13FN4/c10-6-7-2-1-5-14(7)9-8(11)12-3-4-13-9/h3-4,7H,1-2,5-6H2,(H2,11,12) |
| InChIKey | QFLMGUJSQKOPQI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |