C12H19N3O — CID 83063494
3-[1-(3-methylpyrazin-2-yl)pyrrolidin-2-yl]propan-1-ol (PubChem CID 83063494) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[1-(3-methylpyrazin-2-yl)pyrrolidin-2-yl]propan-1-ol.
| Compound Name | 3-[1-(3-methylpyrazin-2-yl)pyrrolidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 83063494 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-[1-(3-methylpyrazin-2-yl)pyrrolidin-2-yl]propan-1-ol |
| SMILES | Cc1nccnc1N1CCCC1CCCO |
| InChI | InChI=1S/C12H19N3O/c1-10-12(14-7-6-13-10)15-8-2-4-11(15)5-3-9-16/h6-7,11,16H,2-5,8-9H2,1H3 |
| InChIKey | SUITZGDLLRZGHC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |