C13H18ClN3 — CID 129413710
(4aS,8aR)-1-(3-chloropyrazin-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 129413710) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-chloropyrazin-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aS,8aR)-1-(3-chloropyrazin-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 129413710 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (4aS,8aR)-1-(3-chloropyrazin-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | Clc1nccnc1N1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C13H18ClN3/c14-12-13(16-8-7-15-12)17-9-3-5-10-4-1-2-6-11(10)17/h7-8,10-11H,1-6,9H2/t10-,11+/m0/s1 |
| InChIKey | BYFVUHPYTOGTDJ-WDEREUQCSA-N |
| XLogP | 3.29 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |