C15H23N3 — CID 81247229
[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-pyridinyl]methanamine (PubChem CID 81247229) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is [4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-pyridinyl]methanamine.
| Compound Name | [4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 81247229 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | [4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-pyridinyl]methanamine |
| SMILES | NCc1cnccc1N1CCCC2CCCCC21 |
| InChI | InChI=1S/C15H23N3/c16-10-13-11-17-8-7-15(13)18-9-3-5-12-4-1-2-6-14(12)18/h7-8,11-12,14H,1-6,9-10,16H2 |
| InChIKey | IFUXBCLZRAJKGP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |