C16H21BrN2O2 — CID 82787750
3-bromo-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzoic acid (PubChem CID 82787750) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 3-bromo-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzoic acid.
| Compound Name | 3-bromo-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzoic acid |
|---|---|
| PubChem CID | 82787750 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-bromo-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzoic acid |
| SMILES | CN1CCCC2CN(c3ccc(C(=O)O)cc3Br)CCC21 |
| InChI | InChI=1S/C16H21BrN2O2/c1-18-7-2-3-12-10-19(8-6-14(12)18)15-5-4-11(16(20)21)9-13(15)17/h4-5,9,12,14H,2-3,6-8,10H2,1H3,(H,20,21) |
| InChIKey | LBRNTMUQCHSTNU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |