C17H24ClN7O5 — CID 54153949
ethyl N-[[(3-amino-6-chloro-5-piperidin-1-ylpyrazine-2-carbonyl)amino]-(ethoxycarbonylamino)methylidene]carbamate (PubChem CID 54153949) has the molecular formula C17H24ClN7O5 and a molecular weight of 441.88 g/mol. Its IUPAC name is ethyl N-[[(3-amino-6-chloro-5-piperidin-1-ylpyrazine-2-carbonyl)amino]-(ethoxycarbonylamino)methylidene]carbamate.
| Compound Name | ethyl N-[[(3-amino-6-chloro-5-piperidin-1-ylpyrazine-2-carbonyl)amino]-(ethoxycarbonylamino)methylidene]carbamate |
|---|---|
| PubChem CID | 54153949 |
| Molecular Formula | C17H24ClN7O5 |
| Molecular Weight | 441.88 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | ethyl N-[[(3-amino-6-chloro-5-piperidin-1-ylpyrazine-2-carbonyl)amino]-(ethoxycarbonylamino)methylidene]carbamate |
| SMILES | CCOC(=O)N=C(NC(=O)OCC)NC(=O)c1nc(Cl)c(N2CCCCC2)nc1N |
| InChI | InChI=1S/C17H24ClN7O5/c1-3-29-16(27)23-15(24-17(28)30-4-2)22-14(26)10-12(19)21-13(11(18)20-10)25-8-6-5-7-9-25/h3-9H2,1-2H3,(H2,19,21)(H2,22,23,24,26,27,28) |
| InChIKey | OJSQVGFPGOHAGX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 161.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.88 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|