C14H20ClN7O5 — CID 88783568
propyl (NE)-N-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-(propoxycarbonylamino)methylidene]carbamate (PubChem CID 88783568) has the molecular formula C14H20ClN7O5 and a molecular weight of 401.81 g/mol. Its IUPAC name is propyl (NE)-N-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-(propoxycarbonylamino)methylidene]carbamate.
| Compound Name | propyl (NE)-N-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-(propoxycarbonylamino)methylidene]carbamate |
|---|---|
| PubChem CID | 88783568 |
| Molecular Formula | C14H20ClN7O5 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | propyl (NE)-N-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-(propoxycarbonylamino)methylidene]carbamate |
| SMILES | CCCOC(=O)/N=C(/NC(=O)OCCC)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C14H20ClN7O5/c1-3-5-26-13(24)21-12(22-14(25)27-6-4-2)20-11(23)7-9(16)19-10(17)8(15)18-7/h3-6H2,1-2H3,(H4,16,17,19)(H2,20,21,22,23,24,25) |
| InChIKey | QVBJGMYJSRNKPM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 183.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|