C9H14ClN5O2 — CID 123418593
1-aminobutyl 3,5-diamino-6-chloropyrazine-2-carboxylate (PubChem CID 123418593) has the molecular formula C9H14ClN5O2 and a molecular weight of 259.70 g/mol. Its IUPAC name is 1-aminobutyl 3,5-diamino-6-chloropyrazine-2-carboxylate.
| Compound Name | 1-aminobutyl 3,5-diamino-6-chloropyrazine-2-carboxylate |
|---|---|
| PubChem CID | 123418593 |
| Molecular Formula | C9H14ClN5O2 |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-aminobutyl 3,5-diamino-6-chloropyrazine-2-carboxylate |
| SMILES | CCCC(N)OC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C9H14ClN5O2/c1-2-3-4(11)17-9(16)5-7(12)15-8(13)6(10)14-5/h4H,2-3,11H2,1H3,(H4,12,13,15) |
| InChIKey | UAIYMVIIYLUGSV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|