C9H12ClN7O5S — CID 87204469
[carbamoyloxy-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylsulfanyl]methyl] carbamate (PubChem CID 87204469) has the molecular formula C9H12ClN7O5S and a molecular weight of 365.76 g/mol. Its IUPAC name is [carbamoyloxy-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylsulfanyl]methyl] carbamate.
| Compound Name | [carbamoyloxy-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylsulfanyl]methyl] carbamate |
|---|---|
| PubChem CID | 87204469 |
| Molecular Formula | C9H12ClN7O5S |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | [carbamoyloxy-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylsulfanyl]methyl] carbamate |
| SMILES | NC(=O)OC(OC(N)=O)SCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C9H12ClN7O5S/c10-3-5(12)17-4(11)2(16-3)6(18)15-1-23-9(21-7(13)19)22-8(14)20/h9H,1H2,(H2,13,19)(H2,14,20)(H,15,18)(H4,11,12,17) |
| InChIKey | KNQADPZOUKJWBQ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 211.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|