C12H22ClN7O — CID 23035418
3,5-diamino-N-[2-(1-aminopentan-3-ylamino)ethyl]-6-chloropyrazine-2-carboxamide (PubChem CID 23035418) has the molecular formula C12H22ClN7O and a molecular weight of 315.81 g/mol. Its IUPAC name is 3,5-diamino-N-[2-(1-aminopentan-3-ylamino)ethyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[2-(1-aminopentan-3-ylamino)ethyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 23035418 |
| Molecular Formula | C12H22ClN7O |
| Molecular Weight | 315.81 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3,5-diamino-N-[2-(1-aminopentan-3-ylamino)ethyl]-6-chloropyrazine-2-carboxamide |
| SMILES | CCC(CCN)NCCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C12H22ClN7O/c1-2-7(3-4-14)17-5-6-18-12(21)8-10(15)20-11(16)9(13)19-8/h7,17H,2-6,14H2,1H3,(H,18,21)(H4,15,16,20) |
| InChIKey | CIWRZTKWKXPSTD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.81 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|