C12H21ClN8O2 — CID 19863349
3,5-diamino-N-[2-[[2-(2-aminoethylamino)-3-oxopropyl]amino]ethyl]-6-chloropyrazine-2-carboxamide (PubChem CID 19863349) has the molecular formula C12H21ClN8O2 and a molecular weight of 344.81 g/mol. Its IUPAC name is 3,5-diamino-N-[2-[[2-(2-aminoethylamino)-3-oxopropyl]amino]ethyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[2-[[2-(2-aminoethylamino)-3-oxopropyl]amino]ethyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 19863349 |
| Molecular Formula | C12H21ClN8O2 |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3,5-diamino-N-[2-[[2-(2-aminoethylamino)-3-oxopropyl]amino]ethyl]-6-chloropyrazine-2-carboxamide |
| SMILES | NCCNC(C=O)CNCCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C12H21ClN8O2/c13-9-11(16)21-10(15)8(20-9)12(23)19-4-3-17-5-7(6-22)18-2-1-14/h6-7,17-18H,1-5,14H2,(H,19,23)(H4,15,16,21) |
| InChIKey | VYXGVPAYJALKDY-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 174.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|