C11H19ClN8O2 — CID 88876197
(3,5-diamino-6-chloropyrazin-2-yl) N-[(2R)-2-(diaminomethylideneamino)pentyl]carbamate (PubChem CID 88876197) has the molecular formula C11H19ClN8O2 and a molecular weight of 330.78 g/mol. Its IUPAC name is (3,5-diamino-6-chloropyrazin-2-yl) N-[(2R)-2-(diaminomethylideneamino)pentyl]carbamate.
| Compound Name | (3,5-diamino-6-chloropyrazin-2-yl) N-[(2R)-2-(diaminomethylideneamino)pentyl]carbamate |
|---|---|
| PubChem CID | 88876197 |
| Molecular Formula | C11H19ClN8O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (3,5-diamino-6-chloropyrazin-2-yl) N-[(2R)-2-(diaminomethylideneamino)pentyl]carbamate |
| SMILES | CCC[C@H](CNC(=O)Oc1nc(Cl)c(N)nc1N)N=C(N)N |
| InChI | InChI=1S/C11H19ClN8O2/c1-2-3-5(18-10(15)16)4-17-11(21)22-9-8(14)20-7(13)6(12)19-9/h5H,2-4H2,1H3,(H,17,21)(H4,13,14,20)(H4,15,16,18)/t5-/m1/s1 |
| InChIKey | NJJNJPOFPNDISB-RXMQYKEDSA-N |
| XLogP | -0.18 |
| TPSA | 180.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|