C8H11ClN4O2 — CID 91619520
(4,5-diamino-6-chloro-2-pyridinyl) N-ethylcarbamate (PubChem CID 91619520) has the molecular formula C8H11ClN4O2 and a molecular weight of 230.66 g/mol. Its IUPAC name is (4,5-diamino-6-chloro-2-pyridinyl) N-ethylcarbamate.
| Compound Name | (4,5-diamino-6-chloro-2-pyridinyl) N-ethylcarbamate |
|---|---|
| PubChem CID | 91619520 |
| Molecular Formula | C8H11ClN4O2 |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (4,5-diamino-6-chloro-2-pyridinyl) N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1cc(N)c(N)c(Cl)n1 |
| InChI | InChI=1S/C8H11ClN4O2/c1-2-12-8(14)15-5-3-4(10)6(11)7(9)13-5/h3H,2,11H2,1H3,(H2,10,13)(H,12,14) |
| InChIKey | DEKWTNCEGOWQQY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|