About (4-bromo-2-methylphenyl) N-ethylcarbamate
(4-bromo-2-methylphenyl) N-ethylcarbamate (PubChem CID 54003233) has the molecular formula C10H12BrNO2
and a molecular weight of 258.11 g/mol. Its IUPAC name is (4-bromo-2-methylphenyl) N-ethylcarbamate.
Molecular Properties
| Compound Name | (4-bromo-2-methylphenyl) N-ethylcarbamate |
| PubChem CID | 54003233 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | (4-bromo-2-methylphenyl) N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1ccc(Br)cc1C |
| InChI | InChI=1S/C10H12BrNO2/c1-3-12-10(13)14-9-5-4-8(11)6-7(9)2/h4-6H,3H2,1-2H3,(H,12,13) |
| InChIKey | KNBSKKNZMKWRFY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-bromo-2-methylphenyl) N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-methylphenyl) N-ethylcarbamate?
The IUPAC name of (4-bromo-2-methylphenyl) N-ethylcarbamate (CID 54003233) is (4-bromo-2-methylphenyl) N-ethylcarbamate.
What is the SMILES notation for (4-bromo-2-methylphenyl) N-ethylcarbamate?
The canonical SMILES for (4-bromo-2-methylphenyl) N-ethylcarbamate is CCNC(=O)Oc1ccc(Br)cc1C.
What is the InChIKey of (4-bromo-2-methylphenyl) N-ethylcarbamate?
The InChIKey is KNBSKKNZMKWRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO2/c1-3-12-10(13)14-9-5-4-8(11)6-7(9)2/h4-6H,3H2,1-2H3,(H,12,13).
What are the key properties of (4-bromo-2-methylphenyl) N-ethylcarbamate?
(4-bromo-2-methylphenyl) N-ethylcarbamate has a molecular weight of 258.11 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-methylphenyl) N-ethylcarbamate is sourced from PubChem (CID 54003233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).