C10H12BrNOS — CID 59715418
O-(4-bromo-2-methylphenyl) N,N-dimethylcarbamothioate (PubChem CID 59715418) has the molecular formula C10H12BrNOS and a molecular weight of 274.18 g/mol. Its IUPAC name is O-(4-bromo-2-methylphenyl) N,N-dimethylcarbamothioate.
| Compound Name | O-(4-bromo-2-methylphenyl) N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 59715418 |
| Molecular Formula | C10H12BrNOS |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | O-(4-bromo-2-methylphenyl) N,N-dimethylcarbamothioate |
| SMILES | Cc1cc(Br)ccc1OC(=S)N(C)C |
| InChI | InChI=1S/C10H12BrNOS/c1-7-6-8(11)4-5-9(7)13-10(14)12(2)3/h4-6H,1-3H3 |
| InChIKey | RMNVDZKEBWFZTQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|