About (4-bromo-2-methylphenyl) prop-2-ynoate
(4-bromo-2-methylphenyl) prop-2-ynoate (PubChem CID 130622286) has the molecular formula C10H7BrO2
and a molecular weight of 239.07 g/mol. Its IUPAC name is (4-bromo-2-methylphenyl) prop-2-ynoate.
Molecular Properties
| Compound Name | (4-bromo-2-methylphenyl) prop-2-ynoate |
| PubChem CID | 130622286 |
| Molecular Formula | C10H7BrO2 |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | (4-bromo-2-methylphenyl) prop-2-ynoate |
| SMILES | C#CC(=O)Oc1ccc(Br)cc1C |
| InChI | InChI=1S/C10H7BrO2/c1-3-10(12)13-9-5-4-8(11)6-7(9)2/h1,4-6H,2H3 |
| InChIKey | WFXROIRSNNVFAR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2-methylphenyl) prop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-methylphenyl) prop-2-ynoate?
The IUPAC name of (4-bromo-2-methylphenyl) prop-2-ynoate (CID 130622286) is (4-bromo-2-methylphenyl) prop-2-ynoate.
What is the SMILES notation for (4-bromo-2-methylphenyl) prop-2-ynoate?
The canonical SMILES for (4-bromo-2-methylphenyl) prop-2-ynoate is C#CC(=O)Oc1ccc(Br)cc1C.
What is the InChIKey of (4-bromo-2-methylphenyl) prop-2-ynoate?
The InChIKey is WFXROIRSNNVFAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO2/c1-3-10(12)13-9-5-4-8(11)6-7(9)2/h1,4-6H,2H3.
What are the key properties of (4-bromo-2-methylphenyl) prop-2-ynoate?
(4-bromo-2-methylphenyl) prop-2-ynoate has a molecular weight of 239.07 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-methylphenyl) prop-2-ynoate is sourced from PubChem (CID 130622286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).