methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate

C11H9BrO2 — CID 64534792

IUPACmethyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate
SMILESCOC(=O)C#Cc1ccc(Br)cc1C
InChIInChI=1S/C11H9BrO2/c1-8-7-10(12)5-3-9(8)4-6-11(13)14-2/h3,5,7H,1-2H3
InChIKeyFQUHCRYIHIHLNR-UHFFFAOYSA-N
MW253.09 g/mol
LogP2.28
Rot. Bonds

About methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate

methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate (PubChem CID 64534792) has the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. Its IUPAC name is methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate.

Molecular Properties

Compound Namemethyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate
PubChem CID64534792
Molecular FormulaC11H9BrO2
Molecular Weight253.09 g/mol
Exact Mass251.98
IUPAC Namemethyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate
SMILESCOC(=O)C#Cc1ccc(Br)cc1C
InChIInChI=1S/C11H9BrO2/c1-8-7-10(12)5-3-9(8)4-6-11(13)14-2/h3,5,7H,1-2H3
InChIKeyFQUHCRYIHIHLNR-UHFFFAOYSA-N
XLogP2.28
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.09
LogP ≤ 52.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate?
The IUPAC name of methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate (CID 64534792) is methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate.
What is the SMILES notation for methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate?
The canonical SMILES for methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate is COC(=O)C#Cc1ccc(Br)cc1C.
What is the InChIKey of methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate?
The InChIKey is FQUHCRYIHIHLNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrO2/c1-8-7-10(12)5-3-9(8)4-6-11(13)14-2/h3,5,7H,1-2H3.
What are the key properties of methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate?
methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate has a molecular weight of 253.09 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-bromo-2-methylphenyl)prop-2-ynoate is sourced from PubChem (CID 64534792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).