C13H18ClN7O5 — CID 54258938
ethyl N-[[[3-amino-6-chloro-5-(methylamino)pyrazine-2-carbonyl]amino]-(ethoxycarbonylamino)methylidene]carbamate (PubChem CID 54258938) has the molecular formula C13H18ClN7O5 and a molecular weight of 387.78 g/mol. Its IUPAC name is ethyl N-[[[3-amino-6-chloro-5-(methylamino)pyrazine-2-carbonyl]amino]-(ethoxycarbonylamino)methylidene]carbamate.
| Compound Name | ethyl N-[[[3-amino-6-chloro-5-(methylamino)pyrazine-2-carbonyl]amino]-(ethoxycarbonylamino)methylidene]carbamate |
|---|---|
| PubChem CID | 54258938 |
| Molecular Formula | C13H18ClN7O5 |
| Molecular Weight | 387.78 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | ethyl N-[[[3-amino-6-chloro-5-(methylamino)pyrazine-2-carbonyl]amino]-(ethoxycarbonylamino)methylidene]carbamate |
| SMILES | CCOC(=O)N=C(NC(=O)OCC)NC(=O)c1nc(Cl)c(NC)nc1N |
| InChI | InChI=1S/C13H18ClN7O5/c1-4-25-12(23)20-11(21-13(24)26-5-2)19-10(22)6-8(15)18-9(16-3)7(14)17-6/h4-5H2,1-3H3,(H3,15,16,18)(H2,19,20,21,22,23,24) |
| InChIKey | RCCFJZWNJVLPRJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 169.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.78 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|