C11H16ClN7O3 — CID 173443331
ethyl N-[N-[3-amino-6-chloro-5-(ethylamino)pyrazine-2-carbonyl]carbamimidoyl]carbamate (PubChem CID 173443331) has the molecular formula C11H16ClN7O3 and a molecular weight of 329.75 g/mol. Its IUPAC name is ethyl N-[N-[3-amino-6-chloro-5-(ethylamino)pyrazine-2-carbonyl]carbamimidoyl]carbamate.
| Compound Name | ethyl N-[N-[3-amino-6-chloro-5-(ethylamino)pyrazine-2-carbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 173443331 |
| Molecular Formula | C11H16ClN7O3 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | ethyl N-[N-[3-amino-6-chloro-5-(ethylamino)pyrazine-2-carbonyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCC)NC(=O)c1nc(Cl)c(NCC)nc1N |
| InChI | InChI=1S/C11H16ClN7O3/c1-3-15-8-6(12)16-5(7(13)17-8)9(20)18-10(14)19-11(21)22-4-2/h3-4H2,1-2H3,(H3,13,15,17)(H3,14,18,19,20,21) |
| InChIKey | MIHCJCMZXXWJFB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 155.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|