C12H18ClN9O2 — CID 173450493
3,5-diamino-6-chloro-N-[N-(4-methylpiperazine-1-carbonyl)carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 173450493) has the molecular formula C12H18ClN9O2 and a molecular weight of 355.79 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N-(4-methylpiperazine-1-carbonyl)carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N-(4-methylpiperazine-1-carbonyl)carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 173450493 |
| Molecular Formula | C12H18ClN9O2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N-(4-methylpiperazine-1-carbonyl)carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | [H]/N=C(/NC(=O)c1nc(Cl)c(N)nc1N)NC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H18ClN9O2/c1-21-2-4-22(5-3-21)12(24)20-11(16)19-10(23)6-8(14)18-9(15)7(13)17-6/h2-5H2,1H3,(H4,14,15,18)(H3,16,19,20,23,24) |
| InChIKey | ZKEBHZYLVIXMRC-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 166.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|