C9H11ClN8OS — CID 88732522
3,5-diamino-6-chloro-N-[(E)-N'-(4,5-dihydro-1,3-thiazol-2-yl)carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 88732522) has the molecular formula C9H11ClN8OS and a molecular weight of 314.76 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[(E)-N'-(4,5-dihydro-1,3-thiazol-2-yl)carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[(E)-N'-(4,5-dihydro-1,3-thiazol-2-yl)carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88732522 |
| Molecular Formula | C9H11ClN8OS |
| Molecular Weight | 314.76 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[(E)-N'-(4,5-dihydro-1,3-thiazol-2-yl)carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\C1=NCCS1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C9H11ClN8OS/c10-4-6(12)16-5(11)3(15-4)7(19)17-8(13)18-9-14-1-2-20-9/h1-2H2,(H4,11,12,16)(H3,13,14,17,18,19) |
| InChIKey | QORNNMJCOUFABG-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.76 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|