C9H12ClN9OS — CID 57265242
1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-2-(4,5-dihydro-1,3-thiazol-2-yl)guanidine (PubChem CID 57265242) has the molecular formula C9H12ClN9OS and a molecular weight of 329.78 g/mol. Its IUPAC name is 1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-2-(4,5-dihydro-1,3-thiazol-2-yl)guanidine.
| Compound Name | 1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-2-(4,5-dihydro-1,3-thiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 57265242 |
| Molecular Formula | C9H12ClN9OS |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-2-(4,5-dihydro-1,3-thiazol-2-yl)guanidine |
| SMILES | NC(=NC1=NCCS1)NNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C9H12ClN9OS/c10-4-6(12)16-5(11)3(15-4)7(20)18-19-8(13)17-9-14-1-2-21-9/h1-2H2,(H,18,20)(H4,11,12,16)(H3,13,14,17,19) |
| InChIKey | UUJLCZVOVKUPHJ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 169.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|