C5H7ClN6 — CID 143760952
3,5-diamino-6-chloropyrazine-2-carboximidamide (PubChem CID 143760952) has the molecular formula C5H7ClN6 and a molecular weight of 186.61 g/mol. Its IUPAC name is 3,5-diamino-6-chloropyrazine-2-carboximidamide.
| Compound Name | 3,5-diamino-6-chloropyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 143760952 |
| Molecular Formula | C5H7ClN6 |
| Molecular Weight | 186.61 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 3,5-diamino-6-chloropyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C5H7ClN6/c6-2-5(10)12-4(9)1(11-2)3(7)8/h(H3,7,8)(H4,9,10,12) |
| InChIKey | QCUYVEFMMZVXAC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.61 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|