C16H29ClN8O — CID 87667873
3,5-diamino-N-(10-aminodecyl)-N-carbamimidoyl-6-chloropyrazine-2-carboxamide (PubChem CID 87667873) has the molecular formula C16H29ClN8O and a molecular weight of 384.92 g/mol. Its IUPAC name is 3,5-diamino-N-(10-aminodecyl)-N-carbamimidoyl-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-(10-aminodecyl)-N-carbamimidoyl-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 87667873 |
| Molecular Formula | C16H29ClN8O |
| Molecular Weight | 384.92 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 3,5-diamino-N-(10-aminodecyl)-N-carbamimidoyl-6-chloropyrazine-2-carboxamide |
| SMILES | [H]/N=C(\N)N(CCCCCCCCCCN)C(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C16H29ClN8O/c17-12-14(20)24-13(19)11(23-12)15(26)25(16(21)22)10-8-6-4-2-1-3-5-7-9-18/h1-10,18H2,(H3,21,22)(H4,19,20,24) |
| InChIKey | YWJIUNXWVBEALX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 174.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.92 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|