C14H22Cl2N14 — CID 23002931
1-[4-[carbamimidoyl-(3,5-diamino-6-chloropyrazin-2-yl)amino]butyl]-1-(3,5-diamino-6-chloropyrazin-2-yl)guanidine (PubChem CID 23002931) has the molecular formula C14H22Cl2N14 and a molecular weight of 457.33 g/mol. Its IUPAC name is 1-[4-[carbamimidoyl-(3,5-diamino-6-chloropyrazin-2-yl)amino]butyl]-1-(3,5-diamino-6-chloropyrazin-2-yl)guanidine.
| Compound Name | 1-[4-[carbamimidoyl-(3,5-diamino-6-chloropyrazin-2-yl)amino]butyl]-1-(3,5-diamino-6-chloropyrazin-2-yl)guanidine |
|---|---|
| PubChem CID | 23002931 |
| Molecular Formula | C14H22Cl2N14 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 1-[4-[carbamimidoyl-(3,5-diamino-6-chloropyrazin-2-yl)amino]butyl]-1-(3,5-diamino-6-chloropyrazin-2-yl)guanidine |
| SMILES | [H]/N=C(\N)N(CCCCN(/C(N)=N/[H])c1nc(Cl)c(N)nc1N)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C14H22Cl2N14/c15-5-7(17)27-9(19)11(25-5)29(13(21)22)3-1-2-4-30(14(23)24)12-10(20)28-8(18)6(16)26-12/h1-4H2,(H3,21,22)(H3,23,24)(H4,17,19,27)(H4,18,20,28) |
| InChIKey | LJKUVQCDMVIBRD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 261.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|