C28H37ClN8O4 — CID 91245633
tert-butyl N-[3-[6-[4-[carbamimidoyl-(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]butyl]naphthalen-2-yl]oxypropyl]carbamate (PubChem CID 91245633) has the molecular formula C28H37ClN8O4 and a molecular weight of 585.11 g/mol. Its IUPAC name is tert-butyl N-[3-[6-[4-[carbamimidoyl-(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]butyl]naphthalen-2-yl]oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[6-[4-[carbamimidoyl-(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]butyl]naphthalen-2-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 91245633 |
| Molecular Formula | C28H37ClN8O4 |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | tert-butyl N-[3-[6-[4-[carbamimidoyl-(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]butyl]naphthalen-2-yl]oxypropyl]carbamate |
| SMILES | [H]/N=C(\N)N(CCCCc1ccc2cc(OCCCNC(=O)OC(C)(C)C)ccc2c1)C(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C28H37ClN8O4/c1-28(2,3)41-27(39)34-12-6-14-40-20-11-10-18-15-17(8-9-19(18)16-20)7-4-5-13-37(26(32)33)25(38)21-23(30)36-24(31)22(29)35-21/h8-11,15-16H,4-7,12-14H2,1-3H3,(H3,32,33)(H,34,39)(H4,30,31,36) |
| InChIKey | DJCJGJUUSGRXNF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 195.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|