C8H9ClN4O — CID 89240906
cyclopropylidene-(3,5-diamino-6-chloropyrazin-2-yl)methanol (PubChem CID 89240906) has the molecular formula C8H9ClN4O and a molecular weight of 212.64 g/mol. Its IUPAC name is cyclopropylidene-(3,5-diamino-6-chloropyrazin-2-yl)methanol.
| Compound Name | cyclopropylidene-(3,5-diamino-6-chloropyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 89240906 |
| Molecular Formula | C8H9ClN4O |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | cyclopropylidene-(3,5-diamino-6-chloropyrazin-2-yl)methanol |
| SMILES | Nc1nc(N)c(C(O)=C2CC2)nc1Cl |
| InChI | InChI=1S/C8H9ClN4O/c9-6-8(11)13-7(10)4(12-6)5(14)3-1-2-3/h14H,1-2H2,(H4,10,11,13) |
| InChIKey | YMTYIAUNCSMFKI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|