C12H16ClN7O8 — CID 25191031
3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 25191031) has the molecular formula C12H16ClN7O8 and a molecular weight of 421.75 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 25191031 |
| Molecular Formula | C12H16ClN7O8 |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | NC(N)=NC(=O)c1nc(Cl)c(N)nc1N.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8ClN7O.C6H8O7/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11;7-3(8)1-6(13,5(11)12)2-4(9)10/h(H4,8,9,13)(H4,10,11,14,15);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | JGQGOJUHHLCSSJ-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 291.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|