C10H13ClN8O3 — CID 58089184
N-[[(2-acetamidoacetyl)amino]-aminomethylidene]-3,5-diamino-6-chloropyrazine-2-carboxamide (PubChem CID 58089184) has the molecular formula C10H13ClN8O3 and a molecular weight of 328.72 g/mol. Its IUPAC name is N-[[(2-acetamidoacetyl)amino]-aminomethylidene]-3,5-diamino-6-chloropyrazine-2-carboxamide.
| Compound Name | N-[[(2-acetamidoacetyl)amino]-aminomethylidene]-3,5-diamino-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58089184 |
| Molecular Formula | C10H13ClN8O3 |
| Molecular Weight | 328.72 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N-[[(2-acetamidoacetyl)amino]-aminomethylidene]-3,5-diamino-6-chloropyrazine-2-carboxamide |
| SMILES | CC(=O)NCC(=O)N/C(N)=N/C(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C10H13ClN8O3/c1-3(20)15-2-4(21)16-10(14)19-9(22)5-7(12)18-8(13)6(11)17-5/h2H2,1H3,(H,15,20)(H4,12,13,18)(H3,14,16,19,21,22) |
| InChIKey | GDUPXFKRTFNESA-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 191.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.72 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|