C10H10ClN9O2 — CID 88807331
3,5-diamino-N-[amino-(1H-imidazole-2-carbonylamino)methylidene]-6-chloropyrazine-2-carboxamide (PubChem CID 88807331) has the molecular formula C10H10ClN9O2 and a molecular weight of 323.70 g/mol. Its IUPAC name is 3,5-diamino-N-[amino-(1H-imidazole-2-carbonylamino)methylidene]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[amino-(1H-imidazole-2-carbonylamino)methylidene]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88807331 |
| Molecular Formula | C10H10ClN9O2 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3,5-diamino-N-[amino-(1H-imidazole-2-carbonylamino)methylidene]-6-chloropyrazine-2-carboxamide |
| SMILES | N/C(=N\C(=O)c1nc(Cl)c(N)nc1N)NC(=O)c1ncc[nH]1 |
| InChI | InChI=1S/C10H10ClN9O2/c11-4-6(13)18-5(12)3(17-4)8(21)19-10(14)20-9(22)7-15-1-2-16-7/h1-2H,(H,15,16)(H4,12,13,18)(H3,14,19,20,21,22) |
| InChIKey | XUHBPBYYSVXSAR-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|