C15H22N6O14 — CID 71369036
bis(2-hydroxypropane-1,2,3-tricarboxylic acid);1,3,5-triazine-2,4,6-triamine (PubChem CID 71369036) has the molecular formula C15H22N6O14 and a molecular weight of 510.37 g/mol. Its IUPAC name is bis(2-hydroxypropane-1,2,3-tricarboxylic acid);1,3,5-triazine-2,4,6-triamine.
| Compound Name | bis(2-hydroxypropane-1,2,3-tricarboxylic acid);1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 71369036 |
| Molecular Formula | C15H22N6O14 |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | bis(2-hydroxypropane-1,2,3-tricarboxylic acid);1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(N)n1.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/2C6H8O7.C3H6N6/c2*7-3(8)1-6(13,5(11)12)2-4(9)10;4-1-7-2(5)9-3(6)8-1/h2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);(H6,4,5,6,7,8,9) |
| InChIKey | BIEDPEJSUDDFTN-UHFFFAOYSA-N |
| XLogP | -3.88 |
| TPSA | 380.99 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |