C6H9ClO7Pb — CID 173449245
chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 173449245) has the molecular formula C6H9ClO7Pb and a molecular weight of 435.78 g/mol. Its IUPAC name is chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 173449245 |
| Molecular Formula | C6H9ClO7Pb |
| Molecular Weight | 435.78 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | Cl[PbH].O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.ClH.Pb.H/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H;;/q;;+1;/p-1 |
| InChIKey | HDCIWDNFNSQPLC-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.78 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |