chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid

C6H9ClO7Pb — CID 173449245

IUPACchloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid
SMILESCl[PbH].O=C(O)CC(O)(CC(=O)O)C(=O)O
InChIInChI=1S/C6H8O7.ClH.Pb.H/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H;;/q;;+1;/p-1
InChIKeyHDCIWDNFNSQPLC-UHFFFAOYSA-M
MW435.78 g/mol
LogP-1.21
Rot. Bonds5

About chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid

chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 173449245) has the molecular formula C6H9ClO7Pb and a molecular weight of 435.78 g/mol. Its IUPAC name is chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid.

Molecular Properties

Compound Namechloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid
PubChem CID173449245
Molecular FormulaC6H9ClO7Pb
Molecular Weight435.78 g/mol
Exact Mass435.98
IUPAC Namechloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid
SMILESCl[PbH].O=C(O)CC(O)(CC(=O)O)C(=O)O
InChIInChI=1S/C6H8O7.ClH.Pb.H/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H;;/q;;+1;/p-1
InChIKeyHDCIWDNFNSQPLC-UHFFFAOYSA-M
XLogP-1.21
TPSA132.13 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500435.78
LogP ≤ 5-1.21
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid?
The IUPAC name of chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid (CID 173449245) is chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid.
What is the SMILES notation for chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid?
The canonical SMILES for chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid is Cl[PbH].O=C(O)CC(O)(CC(=O)O)C(=O)O.
What is the InChIKey of chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid?
The InChIKey is HDCIWDNFNSQPLC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8O7.ClH.Pb.H/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H;;/q;;+1;/p-1.
What are the key properties of chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid?
chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid has a molecular weight of 435.78 g/mol, XLogP of -1.21, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-λ2-plumbane;2-hydroxypropane-1,2,3-tricarboxylic acid is sourced from PubChem (CID 173449245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).