C6H9ClFN7O — CID 70616529
3,5-diamino-N-(diaminomethylidene)-6-fluoropyrazine-2-carboxamide;hydrochloride (PubChem CID 70616529) has the molecular formula C6H9ClFN7O and a molecular weight of 249.64 g/mol. Its IUPAC name is 3,5-diamino-N-(diaminomethylidene)-6-fluoropyrazine-2-carboxamide;hydrochloride.
| Compound Name | 3,5-diamino-N-(diaminomethylidene)-6-fluoropyrazine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70616529 |
| Molecular Formula | C6H9ClFN7O |
| Molecular Weight | 249.64 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 3,5-diamino-N-(diaminomethylidene)-6-fluoropyrazine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1nc(F)c(N)nc1N |
| InChI | InChI=1S/C6H8FN7O.ClH/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11;/h(H4,8,9,13)(H4,10,11,14,15);1H |
| InChIKey | FMADIRTUBLVXSP-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 159.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.64 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|