C13H21ClN8O3S — CID 173443286
3-amino-6-chloro-N-[N'-(dimethylsulfamoyl)carbamimidoyl]-5-piperidin-1-ylpyrazine-2-carboxamide (PubChem CID 173443286) has the molecular formula C13H21ClN8O3S and a molecular weight of 404.88 g/mol. Its IUPAC name is 3-amino-6-chloro-N-[N'-(dimethylsulfamoyl)carbamimidoyl]-5-piperidin-1-ylpyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-N-[N'-(dimethylsulfamoyl)carbamimidoyl]-5-piperidin-1-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 173443286 |
| Molecular Formula | C13H21ClN8O3S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 3-amino-6-chloro-N-[N'-(dimethylsulfamoyl)carbamimidoyl]-5-piperidin-1-ylpyrazine-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)N=C(N)NC(=O)c1nc(Cl)c(N2CCCCC2)nc1N |
| InChI | InChI=1S/C13H21ClN8O3S/c1-21(2)26(24,25)20-13(16)19-12(23)8-10(15)18-11(9(14)17-8)22-6-4-3-5-7-22/h3-7H2,1-2H3,(H2,15,18)(H3,16,19,20,23) |
| InChIKey | NBUUSRCANPWYQC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|