C11H19ClN8O3S — CID 173443106
3-amino-6-chloro-N-[N'-(dimethylsulfamoyl)carbamimidoyl]-5-(propan-2-ylamino)pyrazine-2-carboxamide (PubChem CID 173443106) has the molecular formula C11H19ClN8O3S and a molecular weight of 378.85 g/mol. Its IUPAC name is 3-amino-6-chloro-N-[N'-(dimethylsulfamoyl)carbamimidoyl]-5-(propan-2-ylamino)pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-N-[N'-(dimethylsulfamoyl)carbamimidoyl]-5-(propan-2-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 173443106 |
| Molecular Formula | C11H19ClN8O3S |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-amino-6-chloro-N-[N'-(dimethylsulfamoyl)carbamimidoyl]-5-(propan-2-ylamino)pyrazine-2-carboxamide |
| SMILES | CC(C)Nc1nc(N)c(C(=O)NC(N)=NS(=O)(=O)N(C)C)nc1Cl |
| InChI | InChI=1S/C11H19ClN8O3S/c1-5(2)15-9-7(12)16-6(8(13)17-9)10(21)18-11(14)19-24(22,23)20(3)4/h5H,1-4H3,(H3,13,15,17)(H3,14,18,19,21) |
| InChIKey | KHYXFLPGWFOEFU-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|