C8H13FN8O3S — CID 88783562
3,5-diamino-N-[(E)-N'-(dimethylsulfamoyl)carbamimidoyl]-6-fluoropyrazine-2-carboxamide (PubChem CID 88783562) has the molecular formula C8H13FN8O3S and a molecular weight of 320.31 g/mol. Its IUPAC name is 3,5-diamino-N-[(E)-N'-(dimethylsulfamoyl)carbamimidoyl]-6-fluoropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[(E)-N'-(dimethylsulfamoyl)carbamimidoyl]-6-fluoropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88783562 |
| Molecular Formula | C8H13FN8O3S |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3,5-diamino-N-[(E)-N'-(dimethylsulfamoyl)carbamimidoyl]-6-fluoropyrazine-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)/N=C(\N)NC(=O)c1nc(F)c(N)nc1N |
| InChI | InChI=1S/C8H13FN8O3S/c1-17(2)21(19,20)16-8(12)15-7(18)3-5(10)14-6(11)4(9)13-3/h1-2H3,(H4,10,11,14)(H3,12,15,16,18) |
| InChIKey | WAHHIXFVQJVDPL-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 182.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|