C9H15ClN6S — CID 54029763
methyl N'-[3-amino-6-chloro-5-(propan-2-ylamino)pyrazin-2-yl]carbamimidothioate (PubChem CID 54029763) has the molecular formula C9H15ClN6S and a molecular weight of 274.78 g/mol. Its IUPAC name is methyl N'-[3-amino-6-chloro-5-(propan-2-ylamino)pyrazin-2-yl]carbamimidothioate.
| Compound Name | methyl N'-[3-amino-6-chloro-5-(propan-2-ylamino)pyrazin-2-yl]carbamimidothioate |
|---|---|
| PubChem CID | 54029763 |
| Molecular Formula | C9H15ClN6S |
| Molecular Weight | 274.78 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | methyl N'-[3-amino-6-chloro-5-(propan-2-ylamino)pyrazin-2-yl]carbamimidothioate |
| SMILES | CSC(N)=Nc1nc(Cl)c(NC(C)C)nc1N |
| InChI | InChI=1S/C9H15ClN6S/c1-4(2)13-7-5(10)14-8(6(11)15-7)16-9(12)17-3/h4H,1-3H3,(H3,11,13,15)(H2,12,14,16) |
| InChIKey | LETAJXNTSHZJOM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.78 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|