C9H10ClN5 — CID 90037538
3-chloro-N-propan-2-ylpyrazino[2,3-d]pyridazin-2-amine (PubChem CID 90037538) has the molecular formula C9H10ClN5 and a molecular weight of 223.67 g/mol. Its IUPAC name is 3-chloro-N-propan-2-ylpyrazino[2,3-d]pyridazin-2-amine.
| Compound Name | 3-chloro-N-propan-2-ylpyrazino[2,3-d]pyridazin-2-amine |
|---|---|
| PubChem CID | 90037538 |
| Molecular Formula | C9H10ClN5 |
| Molecular Weight | 223.67 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 3-chloro-N-propan-2-ylpyrazino[2,3-d]pyridazin-2-amine |
| SMILES | CC(C)Nc1nc2cnncc2nc1Cl |
| InChI | InChI=1S/C9H10ClN5/c1-5(2)13-9-8(10)14-6-3-11-12-4-7(6)15-9/h3-5H,1-2H3,(H,13,15) |
| InChIKey | DSMWTTWIWDTZGK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.67 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |