C32H24Cl2F6N8 — CID 161092415
2-chloro-N-propan-2-yl-3-(2,4,6-trifluorophenyl)pyrido[2,3-d]pyridazin-4-amine;4-chloro-N-propan-2-yl-3-(2,4,6-trifluorophenyl)pyrido[2,3-d]pyridazin-2-amine (PubChem CID 161092415) has the molecular formula C32H24Cl2F6N8 and a molecular weight of 705.49 g/mol. Its IUPAC name is 2-chloro-N-propan-2-yl-3-(2,4,6-trifluorophenyl)pyrido[2,3-d]pyridazin-4-amine;4-chloro-N-propan-2-yl-3-(2,4,6-trifluorophenyl)pyrido[2,3-d]pyridazin-2-amine.
| Compound Name | 2-chloro-N-propan-2-yl-3-(2,4,6-trifluorophenyl)pyrido[2,3-d]pyridazin-4-amine;4-chloro-N-propan-2-yl-3-(2,4,6-trifluorophenyl)pyrido[2,3-d]pyridazin-2-amine |
|---|---|
| PubChem CID | 161092415 |
| Molecular Formula | C32H24Cl2F6N8 |
| Molecular Weight | 705.49 g/mol |
| Exact Mass | 704.14 |
| IUPAC Name | 2-chloro-N-propan-2-yl-3-(2,4,6-trifluorophenyl)pyrido[2,3-d]pyridazin-4-amine;4-chloro-N-propan-2-yl-3-(2,4,6-trifluorophenyl)pyrido[2,3-d]pyridazin-2-amine |
| SMILES | CC(C)Nc1c(-c2c(F)cc(F)cc2F)c(Cl)nc2cnncc12.CC(C)Nc1nc2cnncc2c(Cl)c1-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/2C16H12ClF3N4/c1-7(2)23-15-9-5-21-22-6-12(9)24-16(17)14(15)13-10(19)3-8(18)4-11(13)20;1-7(2)23-16-14(13-10(19)3-8(18)4-11(13)20)15(17)9-5-21-22-6-12(9)24-16/h2*3-7H,1-2H3,(H,23,24) |
| InChIKey | UHIXVJPNZYDBKW-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.49 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|