C19H14ClF6N5 — CID 59833601
6-chloro-2-(2-phenylhydrazinyl)-5-(2,4,6-trifluorophenyl)-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidin-4-amine (PubChem CID 59833601) has the molecular formula C19H14ClF6N5 and a molecular weight of 461.80 g/mol. Its IUPAC name is 6-chloro-2-(2-phenylhydrazinyl)-5-(2,4,6-trifluorophenyl)-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-(2-phenylhydrazinyl)-5-(2,4,6-trifluorophenyl)-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 59833601 |
| Molecular Formula | C19H14ClF6N5 |
| Molecular Weight | 461.80 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 6-chloro-2-(2-phenylhydrazinyl)-5-(2,4,6-trifluorophenyl)-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidin-4-amine |
| SMILES | C[C@H](Nc1nc(NNc2ccccc2)nc(Cl)c1-c1c(F)cc(F)cc1F)C(F)(F)F |
| InChI | InChI=1S/C19H14ClF6N5/c1-9(19(24,25)26)27-17-15(14-12(22)7-10(21)8-13(14)23)16(20)28-18(29-17)31-30-11-5-3-2-4-6-11/h2-9,30H,1H3,(H2,27,28,29,31)/t9-/m0/s1 |
| InChIKey | IICODLKDSKHPRX-VIFPVBQESA-N |
| XLogP | 6.02 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.80 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|