C13H10ClF6N5 — CID 73002031
6-chloro-2-hydrazinyl-5-(2,4,6-trifluorophenyl)-N-(1,1,1-trifluoropropan-2-yl)pyrimidin-4-amine (PubChem CID 73002031) has the molecular formula C13H10ClF6N5 and a molecular weight of 385.70 g/mol. Its IUPAC name is 6-chloro-2-hydrazinyl-5-(2,4,6-trifluorophenyl)-N-(1,1,1-trifluoropropan-2-yl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-hydrazinyl-5-(2,4,6-trifluorophenyl)-N-(1,1,1-trifluoropropan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 73002031 |
| Molecular Formula | C13H10ClF6N5 |
| Molecular Weight | 385.70 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 6-chloro-2-hydrazinyl-5-(2,4,6-trifluorophenyl)-N-(1,1,1-trifluoropropan-2-yl)pyrimidin-4-amine |
| SMILES | CC(Nc1nc(NN)nc(Cl)c1-c1c(F)cc(F)cc1F)C(F)(F)F |
| InChI | InChI=1S/C13H10ClF6N5/c1-4(13(18,19)20)22-11-9(10(14)23-12(24-11)25-21)8-6(16)2-5(15)3-7(8)17/h2-4H,21H2,1H3,(H2,22,23,24,25) |
| InChIKey | AGLPZOOTVWMEOI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|